C25H33N7O2S — CID 145101723
N-[3-(dimethylamino)propyl]-N-methylformamide;N-(6-methoxypyrazolo[1,5-a]pyridin-5-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 145101723) has the molecular formula C25H33N7O2S and a molecular weight of 495.65 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-methylformamide;N-(6-methoxypyrazolo[1,5-a]pyridin-5-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[3-(dimethylamino)propyl]-N-methylformamide;N-(6-methoxypyrazolo[1,5-a]pyridin-5-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 145101723 |
| Molecular Formula | C25H33N7O2S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-methylformamide;N-(6-methoxypyrazolo[1,5-a]pyridin-5-yl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CN(C)CCCN(C)C=O.COc1cn2nccc2cc1Nc1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H17N5OS.C7H16N2O/c1-24-14-9-23-11(6-7-21-23)8-13(14)22-17-16-12-4-2-3-5-15(12)25-18(16)20-10-19-17;1-8(2)5-4-6-9(3)7-10/h6-10H,2-5H2,1H3,(H,19,20,22);7H,4-6H2,1-3H3 |
| InChIKey | JJKAFIABTSSOLM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|