C12H10N2O2 — CID 145101951
5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazole (PubChem CID 145101951) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 145101951 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazole |
| SMILES | Cc1ccc(C)c2oc(-c3ncno3)cc12 |
| InChI | InChI=1S/C12H10N2O2/c1-7-3-4-8(2)11-9(7)5-10(15-11)12-13-6-14-16-12/h3-6H,1-2H3 |
| InChIKey | ACLUFONNPCIORR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |