C19H13N2NaO4 — CID 155567657
sodium 4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 155567657) has the molecular formula C19H13N2NaO4 and a molecular weight of 356.31 g/mol. Its IUPAC name is sodium 4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | sodium 4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 155567657 |
| Molecular Formula | C19H13N2NaO4 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | sodium 4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | Cc1ccc(C)c2oc(-c3nc(-c4ccc(C(=O)[O-])cc4)no3)cc12.[Na+] |
| InChI | InChI=1S/C19H14N2O4.Na/c1-10-3-4-11(2)16-14(10)9-15(24-16)18-20-17(21-25-18)12-5-7-13(8-6-12)19(22)23;/h3-9H,1-2H3,(H,22,23);/q;+1/p-1 |
| InChIKey | AHELRKCVYDQECB-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 92.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |