C28H35F3N4O8 — CID 145102888
4-[2-(cyclopropylmethyl)-8-ethyl-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-b]pyridazin-6-yl]-6-propylmorpholine-2,2,3,3,5,5,6-heptol (PubChem CID 145102888) has the molecular formula C28H35F3N4O8 and a molecular weight of 612.60 g/mol. Its IUPAC name is 4-[2-(cyclopropylmethyl)-8-ethyl-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-b]pyridazin-6-yl]-6-propylmorpholine-2,2,3,3,5,5,6-heptol.
| Compound Name | 4-[2-(cyclopropylmethyl)-8-ethyl-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-b]pyridazin-6-yl]-6-propylmorpholine-2,2,3,3,5,5,6-heptol |
|---|---|
| PubChem CID | 145102888 |
| Molecular Formula | C28H35F3N4O8 |
| Molecular Weight | 612.60 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | 4-[2-(cyclopropylmethyl)-8-ethyl-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]imidazo[1,2-b]pyridazin-6-yl]-6-propylmorpholine-2,2,3,3,5,5,6-heptol |
| SMILES | CCCC1(O)OC(O)(O)C(O)(O)N(c2cc(CC)c3nc(CC4CC4)c(Cc4cccc(C(F)(F)F)c4C)n3n2)C1(O)O |
| InChI | InChI=1S/C28H35F3N4O8/c1-4-11-24(36)26(37,38)35(27(39,40)28(41,42)43-24)22-14-17(5-2)23-32-20(12-16-9-10-16)21(34(23)33-22)13-18-7-6-8-19(15(18)3)25(29,30)31/h6-8,14,16,36-42H,4-5,9-13H2,1-3H3 |
| InChIKey | SAXUTRONXIKQQB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 184.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.60 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|