C24H35NO2S2 — CID 145102936
5-[(4-ethylcyclohexa-1,5-dien-1-yl)-(2-methylpropyl)amino]sulfanyl-2-(oxan-4-ylmethoxy)benzenethiol (PubChem CID 145102936) has the molecular formula C24H35NO2S2 and a molecular weight of 433.68 g/mol. Its IUPAC name is 5-[(4-ethylcyclohexa-1,5-dien-1-yl)-(2-methylpropyl)amino]sulfanyl-2-(oxan-4-ylmethoxy)benzenethiol.
| Compound Name | 5-[(4-ethylcyclohexa-1,5-dien-1-yl)-(2-methylpropyl)amino]sulfanyl-2-(oxan-4-ylmethoxy)benzenethiol |
|---|---|
| PubChem CID | 145102936 |
| Molecular Formula | C24H35NO2S2 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 5-[(4-ethylcyclohexa-1,5-dien-1-yl)-(2-methylpropyl)amino]sulfanyl-2-(oxan-4-ylmethoxy)benzenethiol |
| SMILES | CCC1C=CC(N(CC(C)C)Sc2ccc(OCC3CCOCC3)c(S)c2)=CC1 |
| InChI | InChI=1S/C24H35NO2S2/c1-4-19-5-7-21(8-6-19)25(16-18(2)3)29-22-9-10-23(24(28)15-22)27-17-20-11-13-26-14-12-20/h5,7-10,15,18-20,28H,4,6,11-14,16-17H2,1-3H3 |
| InChIKey | MAJROPQFIPSZPW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|