C21H34N6OS — CID 145105083
1,3-diazinane;ethane;[1-[6-[2-(methylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]piperidin-3-yl]methanol (PubChem CID 145105083) has the molecular formula C21H34N6OS and a molecular weight of 418.61 g/mol. Its IUPAC name is 1,3-diazinane;ethane;[1-[6-[2-(methylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]piperidin-3-yl]methanol.
| Compound Name | 1,3-diazinane;ethane;[1-[6-[2-(methylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 145105083 |
| Molecular Formula | C21H34N6OS |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 1,3-diazinane;ethane;[1-[6-[2-(methylideneamino)-1,3-thiazol-4-yl]-2-pyridinyl]piperidin-3-yl]methanol |
| SMILES | C1CNCNC1.C=Nc1nc(-c2cccc(N3CCCC(CO)C3)n2)cs1.CC |
| InChI | InChI=1S/C15H18N4OS.C4H10N2.C2H6/c1-16-15-18-13(10-21-15)12-5-2-6-14(17-12)19-7-3-4-11(8-19)9-20;1-2-5-4-6-3-1;1-2/h2,5-6,10-11,20H,1,3-4,7-9H2;5-6H,1-4H2;1-2H3 |
| InChIKey | WPRWWCNXUBVJDN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|