C21H30N6S — CID 145104394
1-[4-[6-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-pyridinyl]-1,3-thiazol-2-yl]-3-ethyl-2-methylguanidine (PubChem CID 145104394) has the molecular formula C21H30N6S and a molecular weight of 398.58 g/mol. Its IUPAC name is 1-[4-[6-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-pyridinyl]-1,3-thiazol-2-yl]-3-ethyl-2-methylguanidine.
| Compound Name | 1-[4-[6-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-pyridinyl]-1,3-thiazol-2-yl]-3-ethyl-2-methylguanidine |
|---|---|
| PubChem CID | 145104394 |
| Molecular Formula | C21H30N6S |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 1-[4-[6-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-pyridinyl]-1,3-thiazol-2-yl]-3-ethyl-2-methylguanidine |
| SMILES | CCN/C(=N\C)Nc1nc(-c2cccc(N3CC[C@H]4CCCCC4C3)n2)cs1 |
| InChI | InChI=1S/C21H30N6S/c1-3-23-20(22-2)26-21-25-18(14-28-21)17-9-6-10-19(24-17)27-12-11-15-7-4-5-8-16(15)13-27/h6,9-10,14-16H,3-5,7-8,11-13H2,1-2H3,(H2,22,23,25,26)/t15-,16?/m1/s1 |
| InChIKey | IESIOVHCBGBAAN-AAFJCEBUSA-N |
| XLogP | 4.23 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|