C17H23N5S — CID 145104855
1-ethyl-2-methyl-3-[4-[1-(methylamino)-2,3-dihydro-1H-inden-4-yl]-1,3-thiazol-2-yl]guanidine (PubChem CID 145104855) has the molecular formula C17H23N5S and a molecular weight of 329.47 g/mol. Its IUPAC name is 1-ethyl-2-methyl-3-[4-[1-(methylamino)-2,3-dihydro-1H-inden-4-yl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 1-ethyl-2-methyl-3-[4-[1-(methylamino)-2,3-dihydro-1H-inden-4-yl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 145104855 |
| Molecular Formula | C17H23N5S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-ethyl-2-methyl-3-[4-[1-(methylamino)-2,3-dihydro-1H-inden-4-yl]-1,3-thiazol-2-yl]guanidine |
| SMILES | CCN/C(=N\C)Nc1nc(-c2cccc3c2CCC3NC)cs1 |
| InChI | InChI=1S/C17H23N5S/c1-4-20-16(19-3)22-17-21-15(10-23-17)13-7-5-6-12-11(13)8-9-14(12)18-2/h5-7,10,14,18H,4,8-9H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | QOOOKJRMKXPQDL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|