C19H22ClN5OS — CID 145105082
1-[4-[2-[(2-chlorocyclohexa-1,5-dien-1-yl)methoxy]-3-pyridinyl]-1,3-thiazol-2-yl]-3-ethyl-2-methylguanidine (PubChem CID 145105082) has the molecular formula C19H22ClN5OS and a molecular weight of 403.94 g/mol. Its IUPAC name is 1-[4-[2-[(2-chlorocyclohexa-1,5-dien-1-yl)methoxy]-3-pyridinyl]-1,3-thiazol-2-yl]-3-ethyl-2-methylguanidine.
| Compound Name | 1-[4-[2-[(2-chlorocyclohexa-1,5-dien-1-yl)methoxy]-3-pyridinyl]-1,3-thiazol-2-yl]-3-ethyl-2-methylguanidine |
|---|---|
| PubChem CID | 145105082 |
| Molecular Formula | C19H22ClN5OS |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 1-[4-[2-[(2-chlorocyclohexa-1,5-dien-1-yl)methoxy]-3-pyridinyl]-1,3-thiazol-2-yl]-3-ethyl-2-methylguanidine |
| SMILES | CCN/C(=N\C)Nc1nc(-c2cccnc2OCC2=C(Cl)CCC=C2)cs1 |
| InChI | InChI=1S/C19H22ClN5OS/c1-3-22-18(21-2)25-19-24-16(12-27-19)14-8-6-10-23-17(14)26-11-13-7-4-5-9-15(13)20/h4,6-8,10,12H,3,5,9,11H2,1-2H3,(H2,21,22,24,25) |
| InChIKey | FOBPVQOECWRNRI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|