About sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide
sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide (PubChem CID 145004696) has the molecular formula C17H19N2NaO2
and a molecular weight of 306.34 g/mol. Its IUPAC name is sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide.
Molecular Properties
| Compound Name | sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide |
| PubChem CID | 145004696 |
| Molecular Formula | C17H19N2NaO2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide |
| SMILES | Oc1ccccc1-c1cccc(N2CCC3CC3C2)n1.[Na+].[OH-] |
| InChI | InChI=1S/C17H18N2O.Na.H2O/c20-16-6-2-1-4-14(16)15-5-3-7-17(18-15)19-9-8-12-10-13(12)11-19;;/h1-7,12-13,20H,8-11H2;;1H2/q;+1;/p-1 |
| InChIKey | HMOROZGXHAUCET-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 66.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide?
The IUPAC name of sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide (CID 145004696) is sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide.
What is the SMILES notation for sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide?
The canonical SMILES for sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide is Oc1ccccc1-c1cccc(N2CCC3CC3C2)n1.[Na+].[OH-].
What is the InChIKey of sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide?
The InChIKey is HMOROZGXHAUCET-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H18N2O.Na.H2O/c20-16-6-2-1-4-14(16)15-5-3-7-17(18-15)19-9-8-12-10-13(12)11-19;;/h1-7,12-13,20H,8-11H2;;1H2/q;+1;/p-1.
What are the key properties of sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide?
sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide has a molecular weight of 306.34 g/mol, XLogP of 0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-[6-(3-azabicyclo[4.1.0]heptan-3-yl)-2-pyridinyl]phenol;hydroxide is sourced from PubChem (CID 145004696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).