C29H30N2O — CID 145105672
1-[5-methyl-1-[2-[(3-prop-1-en-2-yl-1-prop-2-enylindol-5-yl)methyl]prop-2-enyl]indol-3-yl]ethanone (PubChem CID 145105672) has the molecular formula C29H30N2O and a molecular weight of 422.57 g/mol. Its IUPAC name is 1-[5-methyl-1-[2-[(3-prop-1-en-2-yl-1-prop-2-enylindol-5-yl)methyl]prop-2-enyl]indol-3-yl]ethanone.
| Compound Name | 1-[5-methyl-1-[2-[(3-prop-1-en-2-yl-1-prop-2-enylindol-5-yl)methyl]prop-2-enyl]indol-3-yl]ethanone |
|---|---|
| PubChem CID | 145105672 |
| Molecular Formula | C29H30N2O |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-[5-methyl-1-[2-[(3-prop-1-en-2-yl-1-prop-2-enylindol-5-yl)methyl]prop-2-enyl]indol-3-yl]ethanone |
| SMILES | C=CCn1cc(C(=C)C)c2cc(CC(=C)Cn3cc(C(C)=O)c4cc(C)ccc43)ccc21 |
| InChI | InChI=1S/C29H30N2O/c1-7-12-30-17-26(19(2)3)25-15-23(9-11-28(25)30)13-21(5)16-31-18-27(22(6)32)24-14-20(4)8-10-29(24)31/h7-11,14-15,17-18H,1-2,5,12-13,16H2,3-4,6H3 |
| InChIKey | DPUWRIKKVLDZFS-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|