C11H14N2O2 — CID 145106828
ethane;5-(5-methyl-3-pyridinyl)-1,2-oxazol-3-one (PubChem CID 145106828) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is ethane;5-(5-methyl-3-pyridinyl)-1,2-oxazol-3-one.
| Compound Name | ethane;5-(5-methyl-3-pyridinyl)-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 145106828 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | ethane;5-(5-methyl-3-pyridinyl)-1,2-oxazol-3-one |
| SMILES | CC.Cc1cncc(-c2cc(=O)[nH]o2)c1 |
| InChI | InChI=1S/C9H8N2O2.C2H6/c1-6-2-7(5-10-4-6)8-3-9(12)11-13-8;1-2/h2-5H,1H3,(H,11,12);1-2H3 |
| InChIKey | SZHISWQCGPFPPE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |