C13H26N2O3 — CID 145107444
(1,4-diamino-1-oxobutan-2-yl) 6-methyloctanoate (PubChem CID 145107444) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is (1,4-diamino-1-oxobutan-2-yl) 6-methyloctanoate.
| Compound Name | (1,4-diamino-1-oxobutan-2-yl) 6-methyloctanoate |
|---|---|
| PubChem CID | 145107444 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | (1,4-diamino-1-oxobutan-2-yl) 6-methyloctanoate |
| SMILES | CCC(C)CCCCC(=O)OC(CCN)C(N)=O |
| InChI | InChI=1S/C13H26N2O3/c1-3-10(2)6-4-5-7-12(16)18-11(8-9-14)13(15)17/h10-11H,3-9,14H2,1-2H3,(H2,15,17) |
| InChIKey | BAZWJEUHUUJYBM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|