C60H32S4+4 — CID 145107600
2-[2-[6,15-bis(2-methylidenesulfonioethynyl)hexacen-2-yl]-13-(2-methylidenesulfonioethynyl)pentacen-6-yl]ethynyl-methylidenesulfanium (PubChem CID 145107600) has the molecular formula C60H32S4+4 and a molecular weight of 881.18 g/mol. Its IUPAC name is 2-[2-[6,15-bis(2-methylidenesulfonioethynyl)hexacen-2-yl]-13-(2-methylidenesulfonioethynyl)pentacen-6-yl]ethynyl-methylidenesulfanium.
| Compound Name | 2-[2-[6,15-bis(2-methylidenesulfonioethynyl)hexacen-2-yl]-13-(2-methylidenesulfonioethynyl)pentacen-6-yl]ethynyl-methylidenesulfanium |
|---|---|
| PubChem CID | 145107600 |
| Molecular Formula | C60H32S4+4 |
| Molecular Weight | 881.18 g/mol |
| Exact Mass | 880.14 |
| IUPAC Name | 2-[2-[6,15-bis(2-methylidenesulfonioethynyl)hexacen-2-yl]-13-(2-methylidenesulfonioethynyl)pentacen-6-yl]ethynyl-methylidenesulfanium |
| SMILES | C=[S+]C#Cc1c2cc3ccccc3cc2c(C#C[S+]=C)c2cc3cc(-c4ccc5cc6c(C#C[S+]=C)c7cc8cc9ccccc9cc8cc7c(C#C[S+]=C)c6cc5c4)ccc3cc12 |
| InChI | InChI=1S/C60H32S4/c1-61-21-17-49-53-29-39-11-7-8-12-40(39)30-54(53)50(18-22-62-2)57-33-45-27-41(13-15-43(45)31-55(49)57)42-14-16-44-32-56-51(19-23-63-3)59-35-47-25-37-9-5-6-10-38(37)26-48(47)36-60(59)52(20-24-64-4)58(56)34-46(44)28-42/h5-16,25-36H,1-4H2/q+4 |
| InChIKey | UCBXZAYLLFFTLX-UHFFFAOYSA-N |
| XLogP | 13.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.18 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|