About carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+)
carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+) (PubChem CID 145109269) has the molecular formula C11H18NO4Rb
and a molecular weight of 313.74 g/mol. Its IUPAC name is carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+).
Molecular Properties
| Compound Name | carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+) |
| PubChem CID | 145109269 |
| Molecular Formula | C11H18NO4Rb |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+) |
| SMILES | CCOC(=O)CC1CCC([N-]C(=O)O)CC1.[Rb+] |
| InChI | InChI=1S/C11H18NO4.Rb/c1-2-16-10(13)7-8-3-5-9(6-4-8)12-11(14)15;/h8-9H,2-7H2,1H3,(H,14,15);/q-1;+1 |
| InChIKey | LJFRTWTWTGSTTQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 77.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+)?
The IUPAC name of carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+) (CID 145109269) is carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+).
What is the SMILES notation for carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+)?
The canonical SMILES for carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+) is CCOC(=O)CC1CCC([N-]C(=O)O)CC1.[Rb+].
What is the InChIKey of carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+)?
The InChIKey is LJFRTWTWTGSTTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18NO4.Rb/c1-2-16-10(13)7-8-3-5-9(6-4-8)12-11(14)15;/h8-9H,2-7H2,1H3,(H,14,15);/q-1;+1.
What are the key properties of carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+)?
carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+) has a molecular weight of 313.74 g/mol, XLogP of -0.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carboxy-[4-(2-ethoxy-2-oxoethyl)cyclohexyl]azanide;rubidium(1+) is sourced from PubChem (CID 145109269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).