C33H35N5O3 — CID 145112678
(7R,9aS)-7-[8-amino-1-[4-[(1S)-1-(3-cyclopropylphenyl)-1-hydroxyethyl]-3-methoxyphenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one (PubChem CID 145112678) has the molecular formula C33H35N5O3 and a molecular weight of 549.68 g/mol. Its IUPAC name is (7R,9aS)-7-[8-amino-1-[4-[(1S)-1-(3-cyclopropylphenyl)-1-hydroxyethyl]-3-methoxyphenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one.
| Compound Name | (7R,9aS)-7-[8-amino-1-[4-[(1S)-1-(3-cyclopropylphenyl)-1-hydroxyethyl]-3-methoxyphenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one |
|---|---|
| PubChem CID | 145112678 |
| Molecular Formula | C33H35N5O3 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | (7R,9aS)-7-[8-amino-1-[4-[(1S)-1-(3-cyclopropylphenyl)-1-hydroxyethyl]-3-methoxyphenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one |
| SMILES | COc1cc(-c2nc([C@@H]3CC[C@H]4C=CCC(=O)N4C3)n3ccnc(N)c23)ccc1[C@@](C)(O)c1cccc(C2CC2)c1 |
| InChI | InChI=1S/C33H35N5O3/c1-33(40,24-6-3-5-21(17-24)20-9-10-20)26-14-12-22(18-27(26)41-2)29-30-31(34)35-15-16-37(30)32(36-29)23-11-13-25-7-4-8-28(39)38(25)19-23/h3-7,12,14-18,20,23,25,40H,8-11,13,19H2,1-2H3,(H2,34,35)/t23-,25-,33+/m1/s1 |
| InChIKey | JYRSDRQVWMZMJE-RQLSVGFYSA-N |
| XLogP | 5.15 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|