C30H31N5O2 — CID 145113859
(7R,9aS)-7-[8-amino-1-[4-[(1S)-1-(2-methoxyphenyl)ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one (PubChem CID 145113859) has the molecular formula C30H31N5O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is (7R,9aS)-7-[8-amino-1-[4-[(1S)-1-(2-methoxyphenyl)ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one.
| Compound Name | (7R,9aS)-7-[8-amino-1-[4-[(1S)-1-(2-methoxyphenyl)ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one |
|---|---|
| PubChem CID | 145113859 |
| Molecular Formula | C30H31N5O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | (7R,9aS)-7-[8-amino-1-[4-[(1S)-1-(2-methoxyphenyl)ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one |
| SMILES | COc1ccccc1[C@@H](C)c1ccc(-c2nc([C@@H]3CC[C@H]4C=CCC(=O)N4C3)n3ccnc(N)c23)cc1 |
| InChI | InChI=1S/C30H31N5O2/c1-19(24-7-3-4-8-25(24)37-2)20-10-12-21(13-11-20)27-28-29(31)32-16-17-34(28)30(33-27)22-14-15-23-6-5-9-26(36)35(23)18-22/h3-8,10-13,16-17,19,22-23H,9,14-15,18H2,1-2H3,(H2,31,32)/t19-,22+,23+/m0/s1 |
| InChIKey | AVKHCRKPYQQTLT-WWPVKYPJSA-N |
| XLogP | 5.17 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|