C29H24ClF4N5O2 — CID 145113832
(7R,9aS)-7-[8-amino-5-chloro-1-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]-hydroxymethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one (PubChem CID 145113832) has the molecular formula C29H24ClF4N5O2 and a molecular weight of 585.99 g/mol. Its IUPAC name is (7R,9aS)-7-[8-amino-5-chloro-1-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]-hydroxymethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one.
| Compound Name | (7R,9aS)-7-[8-amino-5-chloro-1-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]-hydroxymethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one |
|---|---|
| PubChem CID | 145113832 |
| Molecular Formula | C29H24ClF4N5O2 |
| Molecular Weight | 585.99 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | (7R,9aS)-7-[8-amino-5-chloro-1-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]-hydroxymethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-3,6,7,8,9,9a-hexahydroquinolizin-4-one |
| SMILES | Nc1ncc(Cl)n2c([C@@H]3CC[C@H]4C=CCC(=O)N4C3)nc(-c3ccc(C(O)c4cc(C(F)(F)F)ccc4F)cc3)c12 |
| InChI | InChI=1S/C29H24ClF4N5O2/c30-22-13-36-27(35)25-24(37-28(39(22)25)17-8-10-19-2-1-3-23(40)38(19)14-17)15-4-6-16(7-5-15)26(41)20-12-18(29(32,33)34)9-11-21(20)31/h1-2,4-7,9,11-13,17,19,26,41H,3,8,10,14H2,(H2,35,36)/t17-,19-,26?/m1/s1 |
| InChIKey | KKMQULWDCIVJPK-HUKSEONBSA-N |
| XLogP | 5.91 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.99 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|