C39H52FNO7 — CID 145114963
benzyl 3-[(4R)-4-(cyclopropylmethoxy)-3-[(4-fluorophenyl)methyl]-5-phenylmethoxyhexoxy]propanoate;tert-butyl carbamate (PubChem CID 145114963) has the molecular formula C39H52FNO7 and a molecular weight of 665.84 g/mol. Its IUPAC name is benzyl 3-[(4R)-4-(cyclopropylmethoxy)-3-[(4-fluorophenyl)methyl]-5-phenylmethoxyhexoxy]propanoate;tert-butyl carbamate.
| Compound Name | benzyl 3-[(4R)-4-(cyclopropylmethoxy)-3-[(4-fluorophenyl)methyl]-5-phenylmethoxyhexoxy]propanoate;tert-butyl carbamate |
|---|---|
| PubChem CID | 145114963 |
| Molecular Formula | C39H52FNO7 |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 665.37 |
| IUPAC Name | benzyl 3-[(4R)-4-(cyclopropylmethoxy)-3-[(4-fluorophenyl)methyl]-5-phenylmethoxyhexoxy]propanoate;tert-butyl carbamate |
| SMILES | CC(C)(C)OC(N)=O.CC(OCc1ccccc1)[C@H](OCC1CC1)C(CCOCCC(=O)OCc1ccccc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C34H41FO5.C5H11NO2/c1-26(38-23-28-8-4-2-5-9-28)34(40-25-30-12-13-30)31(22-27-14-16-32(35)17-15-27)18-20-37-21-19-33(36)39-24-29-10-6-3-7-11-29;1-5(2,3)8-4(6)7/h2-11,14-17,26,30-31,34H,12-13,18-25H2,1H3;1-3H3,(H2,6,7)/t26?,31?,34-;/m0./s1 |
| InChIKey | DNRZLHYXVLHEJY-OTFLOLDRSA-N |
| XLogP | 7.81 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|