C28H40FNO6 — CID 145073978
tert-butyl carbamate;methyl 4-[1-(4-fluorophenyl)-4-phenylmethoxypentan-2-yl]oxybutanoate (PubChem CID 145073978) has the molecular formula C28H40FNO6 and a molecular weight of 505.63 g/mol. Its IUPAC name is tert-butyl carbamate;methyl 4-[1-(4-fluorophenyl)-4-phenylmethoxypentan-2-yl]oxybutanoate.
| Compound Name | tert-butyl carbamate;methyl 4-[1-(4-fluorophenyl)-4-phenylmethoxypentan-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 145073978 |
| Molecular Formula | C28H40FNO6 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | tert-butyl carbamate;methyl 4-[1-(4-fluorophenyl)-4-phenylmethoxypentan-2-yl]oxybutanoate |
| SMILES | CC(C)(C)OC(N)=O.COC(=O)CCCOC(Cc1ccc(F)cc1)CC(C)OCc1ccccc1 |
| InChI | InChI=1S/C23H29FO4.C5H11NO2/c1-18(28-17-20-7-4-3-5-8-20)15-22(27-14-6-9-23(25)26-2)16-19-10-12-21(24)13-11-19;1-5(2,3)8-4(6)7/h3-5,7-8,10-13,18,22H,6,9,14-17H2,1-2H3;1-3H3,(H2,6,7) |
| InChIKey | JRWUGXMPGJOSBT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|