C20H20ClFN4O — CID 145116789
N-(3-chlorophenyl)formamide;3-(2-fluorophenyl)-5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 145116789) has the molecular formula C20H20ClFN4O and a molecular weight of 386.86 g/mol. Its IUPAC name is N-(3-chlorophenyl)formamide;3-(2-fluorophenyl)-5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | N-(3-chlorophenyl)formamide;3-(2-fluorophenyl)-5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 145116789 |
| Molecular Formula | C20H20ClFN4O |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-(3-chlorophenyl)formamide;3-(2-fluorophenyl)-5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | CN1CCc2[nH]nc(-c3ccccc3F)c2C1.O=CNc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H14FN3.C7H6ClNO/c1-17-7-6-12-10(8-17)13(16-15-12)9-4-2-3-5-11(9)14;8-6-2-1-3-7(4-6)9-5-10/h2-5H,6-8H2,1H3,(H,15,16);1-5H,(H,9,10) |
| InChIKey | XZTMVAFHVAHESY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|