C32H34ClN5O4 — CID 145117996
7-chloro-3-[2-[6-[(1E,3Z)-1,4-diaminobuta-1,3-dienoxy]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-3-yl]-2-oxoethoxy]naphthalene-2-carboxamide (PubChem CID 145117996) has the molecular formula C32H34ClN5O4 and a molecular weight of 588.11 g/mol. Its IUPAC name is 7-chloro-3-[2-[6-[(1E,3Z)-1,4-diaminobuta-1,3-dienoxy]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-3-yl]-2-oxoethoxy]naphthalene-2-carboxamide.
| Compound Name | 7-chloro-3-[2-[6-[(1E,3Z)-1,4-diaminobuta-1,3-dienoxy]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-3-yl]-2-oxoethoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 145117996 |
| Molecular Formula | C32H34ClN5O4 |
| Molecular Weight | 588.11 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | 7-chloro-3-[2-[6-[(1E,3Z)-1,4-diaminobuta-1,3-dienoxy]-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indol-3-yl]-2-oxoethoxy]naphthalene-2-carboxamide |
| SMILES | CN1CCCC1CCn1cc(C(=O)COc2cc3ccc(Cl)cc3cc2C(N)=O)c2ccc(O/C(N)=C/C=C\N)cc21 |
| InChI | InChI=1S/C32H34ClN5O4/c1-37-12-3-4-23(37)10-13-38-18-27(25-9-8-24(17-28(25)38)42-31(35)5-2-11-34)29(39)19-41-30-16-20-6-7-22(33)14-21(20)15-26(30)32(36)40/h2,5-9,11,14-18,23H,3-4,10,12-13,19,34-35H2,1H3,(H2,36,40)/b11-2-,31-5+ |
| InChIKey | QJGMEDIUJBYAMV-HENBFANVSA-N |
| XLogP | 4.94 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.11 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|