C30H30ClN5O5 — CID 145118004
7-chloro-3-[2-[6-[(1E,3Z)-1,4-diaminobuta-1,3-dienoxy]-1-[2-(3-hydroxyazetidin-1-yl)ethyl]indol-3-yl]-2-oxoethoxy]naphthalene-2-carboxamide (PubChem CID 145118004) has the molecular formula C30H30ClN5O5 and a molecular weight of 576.05 g/mol. Its IUPAC name is 7-chloro-3-[2-[6-[(1E,3Z)-1,4-diaminobuta-1,3-dienoxy]-1-[2-(3-hydroxyazetidin-1-yl)ethyl]indol-3-yl]-2-oxoethoxy]naphthalene-2-carboxamide.
| Compound Name | 7-chloro-3-[2-[6-[(1E,3Z)-1,4-diaminobuta-1,3-dienoxy]-1-[2-(3-hydroxyazetidin-1-yl)ethyl]indol-3-yl]-2-oxoethoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 145118004 |
| Molecular Formula | C30H30ClN5O5 |
| Molecular Weight | 576.05 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 7-chloro-3-[2-[6-[(1E,3Z)-1,4-diaminobuta-1,3-dienoxy]-1-[2-(3-hydroxyazetidin-1-yl)ethyl]indol-3-yl]-2-oxoethoxy]naphthalene-2-carboxamide |
| SMILES | N/C=C\C=C(/N)Oc1ccc2c(C(=O)COc3cc4ccc(Cl)cc4cc3C(N)=O)cn(CCN3CC(O)C3)c2c1 |
| InChI | InChI=1S/C30H30ClN5O5/c31-20-4-3-18-12-28(24(30(34)39)11-19(18)10-20)40-17-27(38)25-16-36(9-8-35-14-21(37)15-35)26-13-22(5-6-23(25)26)41-29(33)2-1-7-32/h1-7,10-13,16,21,37H,8-9,14-15,17,32-33H2,(H2,34,39)/b7-1-,29-2+ |
| InChIKey | PCQORNIZEXUVEA-MUYKNUGQSA-N |
| XLogP | 3.14 |
| TPSA | 159.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.05 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|