C20H24 — CID 145120170
ethane;(4E)-2-methyl-3-methylidene-1-[(Z)-prop-1-enyl]-4-prop-2-enylidenenaphthalene (PubChem CID 145120170) has the molecular formula C20H24 and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;(4E)-2-methyl-3-methylidene-1-[(Z)-prop-1-enyl]-4-prop-2-enylidenenaphthalene.
| Compound Name | ethane;(4E)-2-methyl-3-methylidene-1-[(Z)-prop-1-enyl]-4-prop-2-enylidenenaphthalene |
|---|---|
| PubChem CID | 145120170 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | ethane;(4E)-2-methyl-3-methylidene-1-[(Z)-prop-1-enyl]-4-prop-2-enylidenenaphthalene |
| SMILES | C=C/C=c1\c(=C)c(C)c(/C=C\C)c2ccccc12.CC |
| InChI | InChI=1S/C18H18.C2H6/c1-5-9-15-13(3)14(4)16(10-6-2)18-12-8-7-11-17(15)18;1-2/h5-12H,1,3H2,2,4H3;1-2H3/b10-6-,15-9+; |
| InChIKey | JCJUTIBRWMEEQK-DXPUCIBRSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |