C18H18 — CID 145120171
(4E)-2-methyl-3-methylidene-1-[(Z)-prop-1-enyl]-4-prop-2-enylidenenaphthalene (PubChem CID 145120171) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is (4E)-2-methyl-3-methylidene-1-[(Z)-prop-1-enyl]-4-prop-2-enylidenenaphthalene.
| Compound Name | (4E)-2-methyl-3-methylidene-1-[(Z)-prop-1-enyl]-4-prop-2-enylidenenaphthalene |
|---|---|
| PubChem CID | 145120171 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (4E)-2-methyl-3-methylidene-1-[(Z)-prop-1-enyl]-4-prop-2-enylidenenaphthalene |
| SMILES | C=C/C=c1\c(=C)c(C)c(/C=C\C)c2ccccc12 |
| InChI | InChI=1S/C18H18/c1-5-9-15-13(3)14(4)16(10-6-2)18-12-8-7-11-17(15)18/h5-12H,1,3H2,2,4H3/b10-6-,15-9+ |
| InChIKey | DZCXDVKDUPRPGG-HETRWBEWSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |