C9H14O5S2 — CID 14512333
1,5-bis(ethenylsulfonyl)pentan-3-one (PubChem CID 14512333) has the molecular formula C9H14O5S2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1,5-bis(ethenylsulfonyl)pentan-3-one.
| Compound Name | 1,5-bis(ethenylsulfonyl)pentan-3-one |
|---|---|
| PubChem CID | 14512333 |
| Molecular Formula | C9H14O5S2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 1,5-bis(ethenylsulfonyl)pentan-3-one |
| SMILES | C=CS(=O)(=O)CCC(=O)CCS(=O)(=O)C=C |
| InChI | InChI=1S/C9H14O5S2/c1-3-15(11,12)7-5-9(10)6-8-16(13,14)4-2/h3-4H,1-2,5-8H2 |
| InChIKey | YVRVRPXGLNYHIZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |