C7H12O5S2 — CID 124583387
(1R)-1,3-bis(ethenylsulfonyl)propan-1-ol (PubChem CID 124583387) has the molecular formula C7H12O5S2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1R)-1,3-bis(ethenylsulfonyl)propan-1-ol.
| Compound Name | (1R)-1,3-bis(ethenylsulfonyl)propan-1-ol |
|---|---|
| PubChem CID | 124583387 |
| Molecular Formula | C7H12O5S2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | (1R)-1,3-bis(ethenylsulfonyl)propan-1-ol |
| SMILES | C=CS(=O)(=O)CC[C@H](O)S(=O)(=O)C=C |
| InChI | InChI=1S/C7H12O5S2/c1-3-13(9,10)6-5-7(8)14(11,12)4-2/h3-4,7-8H,1-2,5-6H2/t7-/m1/s1 |
| InChIKey | GTYCPQSJEVDNDF-SSDOTTSWSA-N |
| XLogP | -0.19 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |