About ethane;2-methylbut-1-ene;N-methylethanimine
ethane;2-methylbut-1-ene;N-methylethanimine (PubChem CID 145124477) has the molecular formula C12H29N
and a molecular weight of 187.37 g/mol. Its IUPAC name is ethane;2-methylbut-1-ene;N-methylethanimine.
Molecular Properties
| Compound Name | ethane;2-methylbut-1-ene;N-methylethanimine |
| PubChem CID | 145124477 |
| Molecular Formula | C12H29N |
| Molecular Weight | 187.37 g/mol |
| Exact Mass | 187.23 |
| IUPAC Name | ethane;2-methylbut-1-ene;N-methylethanimine |
| SMILES | C/C=N/C.C=C(C)CC.CC.CC |
| InChI | InChI=1S/C5H10.C3H7N.2C2H6/c1-4-5(2)3;1-3-4-2;2*1-2/h2,4H2,1,3H3;3H,1-2H3;2*1-2H3/b;4-3+;; |
| InChIKey | BKVWPWIPAHSKEE-NXZCPFRHSA-N |
| XLogP | 4.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylbut-1-ene;N-methylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbut-1-ene;N-methylethanimine?
The IUPAC name of ethane;2-methylbut-1-ene;N-methylethanimine (CID 145124477) is ethane;2-methylbut-1-ene;N-methylethanimine.
What is the SMILES notation for ethane;2-methylbut-1-ene;N-methylethanimine?
The canonical SMILES for ethane;2-methylbut-1-ene;N-methylethanimine is C/C=N/C.C=C(C)CC.CC.CC.
What is the InChIKey of ethane;2-methylbut-1-ene;N-methylethanimine?
The InChIKey is BKVWPWIPAHSKEE-NXZCPFRHSA-N. The full InChI is InChI=1S/C5H10.C3H7N.2C2H6/c1-4-5(2)3;1-3-4-2;2*1-2/h2,4H2,1,3H3;3H,1-2H3;2*1-2H3/b;4-3+;;.
What are the key properties of ethane;2-methylbut-1-ene;N-methylethanimine?
ethane;2-methylbut-1-ene;N-methylethanimine has a molecular weight of 187.37 g/mol, XLogP of 4.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbut-1-ene;N-methylethanimine is sourced from PubChem (CID 145124477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).