C10H17N — CID 123188285
N,6-dimethylocta-4,5-dien-1-imine (PubChem CID 123188285) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N,6-dimethylocta-4,5-dien-1-imine.
| Compound Name | N,6-dimethylocta-4,5-dien-1-imine |
|---|---|
| PubChem CID | 123188285 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N,6-dimethylocta-4,5-dien-1-imine |
| SMILES | CCC(C)=C=CCC/C=N/C |
| InChI | InChI=1S/C10H17N/c1-4-10(2)8-6-5-7-9-11-3/h6,9H,4-5,7H2,1-3H3/b11-9+ |
| InChIKey | GERBAPCPLXFSRL-PKNBQFBNSA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|