C9H15N — CID 123927186
6-methylocta-4,5-dien-1-imine (PubChem CID 123927186) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 6-methylocta-4,5-dien-1-imine.
| Compound Name | 6-methylocta-4,5-dien-1-imine |
|---|---|
| PubChem CID | 123927186 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 6-methylocta-4,5-dien-1-imine |
| SMILES | [H]/N=C/CCC=C=C(C)CC |
| InChI | InChI=1S/C9H15N/c1-3-9(2)7-5-4-6-8-10/h5,8,10H,3-4,6H2,1-2H3/b10-8+ |
| InChIKey | MKYKBQWTCWJPPS-CSKARUKUSA-N |
| XLogP | 2.93 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|