C19H20F3NO8S — CID 145128884
[(3R,6R)-3,5-diacetyloxy-6-sulfanyl-4-[(3,4,5-trifluorobenzoyl)amino]oxan-2-yl]methyl acetate (PubChem CID 145128884) has the molecular formula C19H20F3NO8S and a molecular weight of 479.43 g/mol. Its IUPAC name is [(3R,6R)-3,5-diacetyloxy-6-sulfanyl-4-[(3,4,5-trifluorobenzoyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,5-diacetyloxy-6-sulfanyl-4-[(3,4,5-trifluorobenzoyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 145128884 |
| Molecular Formula | C19H20F3NO8S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | [(3R,6R)-3,5-diacetyloxy-6-sulfanyl-4-[(3,4,5-trifluorobenzoyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](S)C(OC(C)=O)C(NC(=O)c2cc(F)c(F)c(F)c2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H20F3NO8S/c1-7(24)28-6-13-16(29-8(2)25)15(17(19(32)31-13)30-9(3)26)23-18(27)10-4-11(20)14(22)12(21)5-10/h4-5,13,15-17,19,32H,6H2,1-3H3,(H,23,27)/t13?,15?,16-,17?,19+/m0/s1 |
| InChIKey | AAQOAXXLFZEPGR-UKXUOAQXSA-N |
| XLogP | 1.28 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|