C27H29F2N3O3 — CID 145129269
7-(azepan-1-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid;(2-fluorophenyl)methanimine (PubChem CID 145129269) has the molecular formula C27H29F2N3O3 and a molecular weight of 481.54 g/mol. Its IUPAC name is 7-(azepan-1-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid;(2-fluorophenyl)methanimine.
| Compound Name | 7-(azepan-1-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid;(2-fluorophenyl)methanimine |
|---|---|
| PubChem CID | 145129269 |
| Molecular Formula | C27H29F2N3O3 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 7-(azepan-1-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid;(2-fluorophenyl)methanimine |
| SMILES | Cc1c(N2CCCCCC2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12.[H]/N=C/c1ccccc1F |
| InChI | InChI=1S/C20H23FN2O3.C7H6FN/c1-12-17-14(10-16(21)18(12)22-8-4-2-3-5-9-22)19(24)15(20(25)26)11-23(17)13-6-7-13;8-7-4-2-1-3-6(7)5-9/h10-11,13H,2-9H2,1H3,(H,25,26);1-5,9H/b;9-5+ |
| InChIKey | JOXXYFHVCUUYMD-DTDKZNDQSA-N |
| XLogP | 5.69 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|