C27H27FN4O5 — CID 59180834
1-cyclopropyl-6-fluoro-8-methyl-7-[(3R)-3-[(3-nitrophenyl)methylideneamino]azepan-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 59180834) has the molecular formula C27H27FN4O5 and a molecular weight of 506.53 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-8-methyl-7-[(3R)-3-[(3-nitrophenyl)methylideneamino]azepan-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-8-methyl-7-[(3R)-3-[(3-nitrophenyl)methylideneamino]azepan-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 59180834 |
| Molecular Formula | C27H27FN4O5 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-8-methyl-7-[(3R)-3-[(3-nitrophenyl)methylideneamino]azepan-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | Cc1c(N2CCCC[C@@H](/N=C/c3cccc([N+](=O)[O-])c3)C2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C27H27FN4O5/c1-16-24-21(26(33)22(27(34)35)15-31(24)19-8-9-19)12-23(28)25(16)30-10-3-2-6-18(14-30)29-13-17-5-4-7-20(11-17)32(36)37/h4-5,7,11-13,15,18-19H,2-3,6,8-10,14H2,1H3,(H,34,35)/b29-13+/t18-/m1/s1 |
| InChIKey | UOHRMKWUUSMOFI-QDYAICPJSA-N |
| XLogP | 4.87 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|