C22H24O4 — CID 145129314
14-(2-prop-1-en-2-yloxyacetyl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6,13-trien-5-one (PubChem CID 145129314) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 14-(2-prop-1-en-2-yloxyacetyl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6,13-trien-5-one.
| Compound Name | 14-(2-prop-1-en-2-yloxyacetyl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6,13-trien-5-one |
|---|---|
| PubChem CID | 145129314 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 14-(2-prop-1-en-2-yloxyacetyl)-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6,13-trien-5-one |
| SMILES | C=C(C)OCC(=O)C1=CCC2C1CC1OC13C1C=CC(=O)C=C1CCC23 |
| InChI | InChI=1S/C22H24O4/c1-12(2)25-11-20(24)16-6-5-15-17(16)10-21-22(26-21)18-8-4-14(23)9-13(18)3-7-19(15)22/h4,6,8-9,15,17-19,21H,1,3,5,7,10-11H2,2H3 |
| InChIKey | XROLJLIHVPROGH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|