C10H13NO2 — CID 145129839
(2E)-2-ethenylpenta-2,4-dienoic acid;prop-2-en-1-imine (PubChem CID 145129839) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (2E)-2-ethenylpenta-2,4-dienoic acid;prop-2-en-1-imine.
| Compound Name | (2E)-2-ethenylpenta-2,4-dienoic acid;prop-2-en-1-imine |
|---|---|
| PubChem CID | 145129839 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2E)-2-ethenylpenta-2,4-dienoic acid;prop-2-en-1-imine |
| SMILES | C=C/C=C(\C=C)C(=O)O.[H]/N=C/C=C |
| InChI | InChI=1S/C7H8O2.C3H5N/c1-3-5-6(4-2)7(8)9;1-2-3-4/h3-5H,1-2H2,(H,8,9);2-4H,1H2/b6-5+;4-3+ |
| InChIKey | GOCBFZZLRAEFJV-YPXSKRLGSA-N |
| XLogP | 2.19 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|