C21H22Cl2F4N2O3S — CID 145132116
5-chloro-2-fluoro-4-methoxy-N-methylsulfanylbenzamide;1-[3-chloro-4-(trifluoromethoxy)phenyl]piperidine (PubChem CID 145132116) has the molecular formula C21H22Cl2F4N2O3S and a molecular weight of 529.38 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-methoxy-N-methylsulfanylbenzamide;1-[3-chloro-4-(trifluoromethoxy)phenyl]piperidine.
| Compound Name | 5-chloro-2-fluoro-4-methoxy-N-methylsulfanylbenzamide;1-[3-chloro-4-(trifluoromethoxy)phenyl]piperidine |
|---|---|
| PubChem CID | 145132116 |
| Molecular Formula | C21H22Cl2F4N2O3S |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 5-chloro-2-fluoro-4-methoxy-N-methylsulfanylbenzamide;1-[3-chloro-4-(trifluoromethoxy)phenyl]piperidine |
| SMILES | COc1cc(F)c(C(=O)NSC)cc1Cl.FC(F)(F)Oc1ccc(N2CCCCC2)cc1Cl |
| InChI | InChI=1S/C12H13ClF3NO.C9H9ClFNO2S/c13-10-8-9(17-6-2-1-3-7-17)4-5-11(10)18-12(14,15)16;1-14-8-4-7(11)5(3-6(8)10)9(13)12-15-2/h4-5,8H,1-3,6-7H2;3-4H,1-2H3,(H,12,13) |
| InChIKey | HYYLMCLVSDSVSC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|