C21H21ClF4N2O2S — CID 145132004
5-chloro-N-ethylsulfanyl-2-fluoro-4-[[1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]methoxy]benzamide (PubChem CID 145132004) has the molecular formula C21H21ClF4N2O2S and a molecular weight of 476.92 g/mol. Its IUPAC name is 5-chloro-N-ethylsulfanyl-2-fluoro-4-[[1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]methoxy]benzamide.
| Compound Name | 5-chloro-N-ethylsulfanyl-2-fluoro-4-[[1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 145132004 |
| Molecular Formula | C21H21ClF4N2O2S |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 5-chloro-N-ethylsulfanyl-2-fluoro-4-[[1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-yl]methoxy]benzamide |
| SMILES | CCSNC(=O)c1cc(Cl)c(OCC2CCCN2c2ccc(C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C21H21ClF4N2O2S/c1-2-31-27-20(29)16-10-17(22)19(11-18(16)23)30-12-15-4-3-9-28(15)14-7-5-13(6-8-14)21(24,25)26/h5-8,10-11,15H,2-4,9,12H2,1H3,(H,27,29) |
| InChIKey | VJDHSEYJMPNGMI-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|