C20H22Cl2FN3OS — CID 145131842
5-chloro-4-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-N-ethylsulfanyl-2-fluorobenzamide (PubChem CID 145131842) has the molecular formula C20H22Cl2FN3OS and a molecular weight of 442.39 g/mol. Its IUPAC name is 5-chloro-4-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-N-ethylsulfanyl-2-fluorobenzamide.
| Compound Name | 5-chloro-4-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-N-ethylsulfanyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 145131842 |
| Molecular Formula | C20H22Cl2FN3OS |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 5-chloro-4-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-N-ethylsulfanyl-2-fluorobenzamide |
| SMILES | CCSNC(=O)c1cc(Cl)c(CN2CCN(c3ccc(Cl)cc3)CC2)cc1F |
| InChI | InChI=1S/C20H22Cl2FN3OS/c1-2-28-24-20(27)17-12-18(22)14(11-19(17)23)13-25-7-9-26(10-8-25)16-5-3-15(21)4-6-16/h3-6,11-12H,2,7-10,13H2,1H3,(H,24,27) |
| InChIKey | MTAOULPDCCCVFI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|