C22H24ClF4N3O4S — CID 122485888
4-[[4-[3-chloro-4-(trifluoromethoxy)phenyl]piperazin-1-yl]methyl]-5-ethyl-2-fluoro-N-methylsulfonylbenzamide (PubChem CID 122485888) has the molecular formula C22H24ClF4N3O4S and a molecular weight of 537.96 g/mol. Its IUPAC name is 4-[[4-[3-chloro-4-(trifluoromethoxy)phenyl]piperazin-1-yl]methyl]-5-ethyl-2-fluoro-N-methylsulfonylbenzamide.
| Compound Name | 4-[[4-[3-chloro-4-(trifluoromethoxy)phenyl]piperazin-1-yl]methyl]-5-ethyl-2-fluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 122485888 |
| Molecular Formula | C22H24ClF4N3O4S |
| Molecular Weight | 537.96 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 4-[[4-[3-chloro-4-(trifluoromethoxy)phenyl]piperazin-1-yl]methyl]-5-ethyl-2-fluoro-N-methylsulfonylbenzamide |
| SMILES | CCc1cc(C(=O)NS(C)(=O)=O)c(F)cc1CN1CCN(c2ccc(OC(F)(F)F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H24ClF4N3O4S/c1-3-14-10-17(21(31)28-35(2,32)33)19(24)11-15(14)13-29-6-8-30(9-7-29)16-4-5-20(18(23)12-16)34-22(25,26)27/h4-5,10-12H,3,6-9,13H2,1-2H3,(H,28,31) |
| InChIKey | CNBVPRPAJPWGDA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|