C19H18ClF4N3O2S — CID 145131812
5-chloro-2-fluoro-N-methylsulfanyl-4-[[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-2-yl]methoxy]benzamide (PubChem CID 145131812) has the molecular formula C19H18ClF4N3O2S and a molecular weight of 463.88 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-methylsulfanyl-4-[[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-2-yl]methoxy]benzamide.
| Compound Name | 5-chloro-2-fluoro-N-methylsulfanyl-4-[[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 145131812 |
| Molecular Formula | C19H18ClF4N3O2S |
| Molecular Weight | 463.88 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 5-chloro-2-fluoro-N-methylsulfanyl-4-[[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-2-yl]methoxy]benzamide |
| SMILES | CSNC(=O)c1cc(Cl)c(OCC2CCCN2c2ccc(C(F)(F)F)cn2)cc1F |
| InChI | InChI=1S/C19H18ClF4N3O2S/c1-30-26-18(28)13-7-14(20)16(8-15(13)21)29-10-12-3-2-6-27(12)17-5-4-11(9-25-17)19(22,23)24/h4-5,7-9,12H,2-3,6,10H2,1H3,(H,26,28) |
| InChIKey | YLSYQOLQTIYQQJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.88 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|