C18H24ClFN2O4S — CID 145131964
tert-butyl 2-[[2-chloro-5-fluoro-4-(methylsulfanylcarbamoyl)phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 145131964) has the molecular formula C18H24ClFN2O4S and a molecular weight of 418.92 g/mol. Its IUPAC name is tert-butyl 2-[[2-chloro-5-fluoro-4-(methylsulfanylcarbamoyl)phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[2-chloro-5-fluoro-4-(methylsulfanylcarbamoyl)phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145131964 |
| Molecular Formula | C18H24ClFN2O4S |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | tert-butyl 2-[[2-chloro-5-fluoro-4-(methylsulfanylcarbamoyl)phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CSNC(=O)c1cc(Cl)c(OCC2CCCN2C(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C18H24ClFN2O4S/c1-18(2,3)26-17(24)22-7-5-6-11(22)10-25-15-9-14(20)12(8-13(15)19)16(23)21-27-4/h8-9,11H,5-7,10H2,1-4H3,(H,21,23) |
| InChIKey | WEFTWVWJFCQUNP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|