C18H24ClNO5 — CID 139939729
tert-butyl 2-[(2-chloro-6-methoxycarbonylphenoxy)methyl]pyrrolidine-1-carboxylate (PubChem CID 139939729) has the molecular formula C18H24ClNO5 and a molecular weight of 369.85 g/mol. Its IUPAC name is tert-butyl 2-[(2-chloro-6-methoxycarbonylphenoxy)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(2-chloro-6-methoxycarbonylphenoxy)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139939729 |
| Molecular Formula | C18H24ClNO5 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | tert-butyl 2-[(2-chloro-6-methoxycarbonylphenoxy)methyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)c1cccc(Cl)c1OCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24ClNO5/c1-18(2,3)25-17(22)20-10-6-7-12(20)11-24-15-13(16(21)23-4)8-5-9-14(15)19/h5,8-9,12H,6-7,10-11H2,1-4H3 |
| InChIKey | SMSHGSJUBXHEOT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |