C18H24F3NO3 — CID 66643189
tert-butyl 2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)benzoate (PubChem CID 66643189) has the molecular formula C18H24F3NO3 and a molecular weight of 359.39 g/mol. Its IUPAC name is tert-butyl 2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)benzoate.
| Compound Name | tert-butyl 2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 66643189 |
| Molecular Formula | C18H24F3NO3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | tert-butyl 2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)benzoate |
| SMILES | CN1CCC[C@H]1COc1ccc(C(F)(F)F)cc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24F3NO3/c1-17(2,3)25-16(23)14-10-12(18(19,20)21)7-8-15(14)24-11-13-6-5-9-22(13)4/h7-8,10,13H,5-6,9,11H2,1-4H3/t13-/m0/s1 |
| InChIKey | VMHARSLSSIETIM-ZDUSSCGKSA-N |
| XLogP | 4.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |