C16H20F3N3O3 — CID 87348036
2-[[(2S)-1-[(2E)-2-hydroxyiminopropyl]pyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)benzamide (PubChem CID 87348036) has the molecular formula C16H20F3N3O3 and a molecular weight of 359.35 g/mol. Its IUPAC name is 2-[[(2S)-1-[(2E)-2-hydroxyiminopropyl]pyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-[[(2S)-1-[(2E)-2-hydroxyiminopropyl]pyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 87348036 |
| Molecular Formula | C16H20F3N3O3 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[[(2S)-1-[(2E)-2-hydroxyiminopropyl]pyrrolidin-2-yl]methoxy]-5-(trifluoromethyl)benzamide |
| SMILES | C/C(CN1CCC[C@H]1COc1ccc(C(F)(F)F)cc1C(N)=O)=N\O |
| InChI | InChI=1S/C16H20F3N3O3/c1-10(21-24)8-22-6-2-3-12(22)9-25-14-5-4-11(16(17,18)19)7-13(14)15(20)23/h4-5,7,12,24H,2-3,6,8-9H2,1H3,(H2,20,23)/b21-10+/t12-/m0/s1 |
| InChIKey | CKNLOJSYOLGKDU-SQWLXVSWSA-N |
| XLogP | 2.50 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|