C13H14F3NO4S — CID 167907655
2-[(1-methylsulfonylcyclopropyl)methoxy]-5-(trifluoromethyl)benzamide (PubChem CID 167907655) has the molecular formula C13H14F3NO4S and a molecular weight of 337.32 g/mol. Its IUPAC name is 2-[(1-methylsulfonylcyclopropyl)methoxy]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-[(1-methylsulfonylcyclopropyl)methoxy]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 167907655 |
| Molecular Formula | C13H14F3NO4S |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 2-[(1-methylsulfonylcyclopropyl)methoxy]-5-(trifluoromethyl)benzamide |
| SMILES | CS(=O)(=O)C1(COc2ccc(C(F)(F)F)cc2C(N)=O)CC1 |
| InChI | InChI=1S/C13H14F3NO4S/c1-22(19,20)12(4-5-12)7-21-10-3-2-8(13(14,15)16)6-9(10)11(17)18/h2-3,6H,4-5,7H2,1H3,(H2,17,18) |
| InChIKey | QTVOKAWRFWYHAB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |