C19H15Cl2F4NO3 — CID 145132158
1-[5-chloro-4-[1-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]azetidin-3-yl]oxy-2-fluorophenyl]ethanone (PubChem CID 145132158) has the molecular formula C19H15Cl2F4NO3 and a molecular weight of 452.23 g/mol. Its IUPAC name is 1-[5-chloro-4-[1-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]azetidin-3-yl]oxy-2-fluorophenyl]ethanone.
| Compound Name | 1-[5-chloro-4-[1-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]azetidin-3-yl]oxy-2-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 145132158 |
| Molecular Formula | C19H15Cl2F4NO3 |
| Molecular Weight | 452.23 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 1-[5-chloro-4-[1-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]azetidin-3-yl]oxy-2-fluorophenyl]ethanone |
| SMILES | CC(=O)c1cc(Cl)c(OC2CN(c3ccc(OCC(F)(F)F)c(Cl)c3)C2)cc1F |
| InChI | InChI=1S/C19H15Cl2F4NO3/c1-10(27)13-5-15(21)18(6-16(13)22)29-12-7-26(8-12)11-2-3-17(14(20)4-11)28-9-19(23,24)25/h2-6,12H,7-9H2,1H3 |
| InChIKey | MFXSEVLBVPXTNY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.23 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|