C16H21NO3 — CID 145137012
methyl (2E,4Z)-12-(dimethylamino)-6-methylidene-12-oxododeca-2,4-dien-7-ynoate (PubChem CID 145137012) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl (2E,4Z)-12-(dimethylamino)-6-methylidene-12-oxododeca-2,4-dien-7-ynoate.
| Compound Name | methyl (2E,4Z)-12-(dimethylamino)-6-methylidene-12-oxododeca-2,4-dien-7-ynoate |
|---|---|
| PubChem CID | 145137012 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | methyl (2E,4Z)-12-(dimethylamino)-6-methylidene-12-oxododeca-2,4-dien-7-ynoate |
| SMILES | C=C(C#CCCCC(=O)N(C)C)/C=C\C=C\C(=O)OC |
| InChI | InChI=1S/C16H21NO3/c1-14(11-8-9-13-16(19)20-4)10-6-5-7-12-15(18)17(2)3/h8-9,11,13H,1,5,7,12H2,2-4H3/b11-8-,13-9+ |
| InChIKey | IYMWVYCYRWZXLS-ZXXZFBTCSA-N |
| XLogP | 2.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|