C30H36N6S — CID 145137225
2-[(E)-C-ethyl-N-(2-methylhydrazinyl)carbonimidoyl]-5-(4-imidazol-1-yl-2-methylphenyl)-4-[(Z,2E)-2-prop-2-enylidenehept-3-enyl]thieno[3,2-b]pyrrole (PubChem CID 145137225) has the molecular formula C30H36N6S and a molecular weight of 512.73 g/mol. Its IUPAC name is 2-[(E)-C-ethyl-N-(2-methylhydrazinyl)carbonimidoyl]-5-(4-imidazol-1-yl-2-methylphenyl)-4-[(Z,2E)-2-prop-2-enylidenehept-3-enyl]thieno[3,2-b]pyrrole.
| Compound Name | 2-[(E)-C-ethyl-N-(2-methylhydrazinyl)carbonimidoyl]-5-(4-imidazol-1-yl-2-methylphenyl)-4-[(Z,2E)-2-prop-2-enylidenehept-3-enyl]thieno[3,2-b]pyrrole |
|---|---|
| PubChem CID | 145137225 |
| Molecular Formula | C30H36N6S |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 2-[(E)-C-ethyl-N-(2-methylhydrazinyl)carbonimidoyl]-5-(4-imidazol-1-yl-2-methylphenyl)-4-[(Z,2E)-2-prop-2-enylidenehept-3-enyl]thieno[3,2-b]pyrrole |
| SMILES | C=C/C=C(\C=C/CCC)Cn1c(-c2ccc(-n3ccnc3)cc2C)cc2sc(/C(CC)=N/NNC)cc21 |
| InChI | InChI=1S/C30H36N6S/c1-6-9-10-12-23(11-7-2)20-36-27(25-14-13-24(17-22(25)4)35-16-15-32-21-35)18-30-28(36)19-29(37-30)26(8-3)33-34-31-5/h7,10-19,21,31,34H,2,6,8-9,20H2,1,3-5H3/b12-10-,23-11+,33-26+ |
| InChIKey | HJFWJAMXHWSMGX-ZMGRIYHPSA-N |
| XLogP | 7.17 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|