About [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine
[(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine (PubChem CID 145137553) has the molecular formula C12H21AtN2O2
and a molecular weight of 435.31 g/mol. Its IUPAC name is [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine.
Molecular Properties
| Compound Name | [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine |
| PubChem CID | 145137553 |
| Molecular Formula | C12H21AtN2O2 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine |
| SMILES | CC(C)(CO)CN1CC2C(CNC(=O)[At])[C@@H]2C1 |
| InChI | InChI=1S/C12H21AtN2O2/c1-12(2,7-16)6-15-4-9-8(10(9)5-15)3-14-11(13)17/h8-10,16H,3-7H2,1-2H3,(H,14,17)/t8?,9-,10?/m0/s1 |
| InChIKey | YVXCKRNGCCLYTO-KYHHOPLUSA-N |
| XLogP | 0.44 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine?
The IUPAC name of [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine (CID 145137553) is [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine.
What is the SMILES notation for [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine?
The canonical SMILES for [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine is CC(C)(CO)CN1CC2C(CNC(=O)[At])[C@@H]2C1.
What is the InChIKey of [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine?
The InChIKey is YVXCKRNGCCLYTO-KYHHOPLUSA-N. The full InChI is InChI=1S/C12H21AtN2O2/c1-12(2,7-16)6-15-4-9-8(10(9)5-15)3-14-11(13)17/h8-10,16H,3-7H2,1-2H3,(H,14,17)/t8?,9-,10?/m0/s1.
What are the key properties of [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine?
[(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine has a molecular weight of 435.31 g/mol, XLogP of 0.44, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-3-(3-hydroxy-2,2-dimethylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylcarbamoylastatine is sourced from PubChem (CID 145137553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).