C29H48N6O5 — CID 145138628
N,3-dimethyl-N-[(9Z,12Z)-octadeca-9,12-dienoyl]-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide;ethane;methyl formate (PubChem CID 145138628) has the molecular formula C29H48N6O5 and a molecular weight of 560.74 g/mol. Its IUPAC name is N,3-dimethyl-N-[(9Z,12Z)-octadeca-9,12-dienoyl]-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide;ethane;methyl formate.
| Compound Name | N,3-dimethyl-N-[(9Z,12Z)-octadeca-9,12-dienoyl]-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide;ethane;methyl formate |
|---|---|
| PubChem CID | 145138628 |
| Molecular Formula | C29H48N6O5 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | N,3-dimethyl-N-[(9Z,12Z)-octadeca-9,12-dienoyl]-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide;ethane;methyl formate |
| SMILES | CC.CCCCC/C=C\C/C=C\CCCCCCCC(=O)N(C)C(=O)c1ncn2c(=O)n(C)nnc12.COC=O |
| InChI | InChI=1S/C25H38N6O3.C2H4O2.C2H6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(32)29(2)24(33)22-23-27-28-30(3)25(34)31(23)20-26-22;1-4-2-3;1-2/h8-9,11-12,20H,4-7,10,13-19H2,1-3H3;2H,1H3;1-2H3/b9-8-,12-11-;; |
| InChIKey | YMFKCNSAFVEMKT-LTTUFRARSA-N |
| XLogP | 5.05 |
| TPSA | 128.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|